C24H16Cl3NO3 — CID 19559021
(E)-1-(4-pyrrol-1-ylphenyl)-3-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19559021) has the molecular formula C24H16Cl3NO3 and a molecular weight of 472.76 g/mol. Its IUPAC name is (E)-1-(4-pyrrol-1-ylphenyl)-3-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-pyrrol-1-ylphenyl)-3-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19559021 |
| Molecular Formula | C24H16Cl3NO3 |
| Molecular Weight | 472.76 g/mol |
| Exact Mass | 471.02 |
| IUPAC Name | (E)-1-(4-pyrrol-1-ylphenyl)-3-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(COc2c(Cl)cc(Cl)cc2Cl)o1)c1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C24H16Cl3NO3/c25-17-13-21(26)24(22(27)14-17)30-15-20-8-7-19(31-20)9-10-23(29)16-3-5-18(6-4-16)28-11-1-2-12-28/h1-14H,15H2/b10-9+ |
| InChIKey | KVAIJCVOVKBGFB-MDZDMXLPSA-N |
| XLogP | 7.51 |
| TPSA | 44.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.76 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|