C21H15Cl3O4 — CID 19560604
(E)-1-(3-methoxyphenyl)-3-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19560604) has the molecular formula C21H15Cl3O4 and a molecular weight of 437.71 g/mol. Its IUPAC name is (E)-1-(3-methoxyphenyl)-3-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(3-methoxyphenyl)-3-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19560604 |
| Molecular Formula | C21H15Cl3O4 |
| Molecular Weight | 437.71 g/mol |
| Exact Mass | 436.00 |
| IUPAC Name | (E)-1-(3-methoxyphenyl)-3-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | COc1cccc(C(=O)/C=C/c2ccc(COc3c(Cl)cc(Cl)cc3Cl)o2)c1 |
| InChI | InChI=1S/C21H15Cl3O4/c1-26-16-4-2-3-13(9-16)20(25)8-7-15-5-6-17(28-15)12-27-21-18(23)10-14(22)11-19(21)24/h2-11H,12H2,1H3/b8-7+ |
| InChIKey | UHPYXWKJJUDUIV-BQYQJAHWSA-N |
| XLogP | 6.72 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.71 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|