C21H16F2O4 — CID 19560630
(E)-3-[5-[(2,4-difluorophenoxy)methyl]furan-2-yl]-1-(3-methoxyphenyl)prop-2-en-1-one (PubChem CID 19560630) has the molecular formula C21H16F2O4 and a molecular weight of 370.35 g/mol. Its IUPAC name is (E)-3-[5-[(2,4-difluorophenoxy)methyl]furan-2-yl]-1-(3-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(2,4-difluorophenoxy)methyl]furan-2-yl]-1-(3-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19560630 |
| Molecular Formula | C21H16F2O4 |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | (E)-3-[5-[(2,4-difluorophenoxy)methyl]furan-2-yl]-1-(3-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cccc(C(=O)/C=C/c2ccc(COc3ccc(F)cc3F)o2)c1 |
| InChI | InChI=1S/C21H16F2O4/c1-25-17-4-2-3-14(11-17)20(24)9-8-16-6-7-18(27-16)13-26-21-10-5-15(22)12-19(21)23/h2-12H,13H2,1H3/b9-8+ |
| InChIKey | CPVNWSOTPKNFNL-CMDGGOBGSA-N |
| XLogP | 5.04 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|