C22H19ClO5 — CID 19561043
(E)-3-[5-[(2-chlorophenoxy)methyl]furan-2-yl]-1-(3,4-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 19561043) has the molecular formula C22H19ClO5 and a molecular weight of 398.84 g/mol. Its IUPAC name is (E)-3-[5-[(2-chlorophenoxy)methyl]furan-2-yl]-1-(3,4-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(2-chlorophenoxy)methyl]furan-2-yl]-1-(3,4-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19561043 |
| Molecular Formula | C22H19ClO5 |
| Molecular Weight | 398.84 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | (E)-3-[5-[(2-chlorophenoxy)methyl]furan-2-yl]-1-(3,4-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2ccc(COc3ccccc3Cl)o2)cc1OC |
| InChI | InChI=1S/C22H19ClO5/c1-25-21-12-7-15(13-22(21)26-2)19(24)11-10-16-8-9-17(28-16)14-27-20-6-4-3-5-18(20)23/h3-13H,14H2,1-2H3/b11-10+ |
| InChIKey | RERJENHCAALCGX-ZHACJKMWSA-N |
| XLogP | 5.43 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.84 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|