C23H22O6 — CID 19561030
(E)-1-(3,4-dimethoxyphenyl)-3-[5-[(2-methoxyphenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19561030) has the molecular formula C23H22O6 and a molecular weight of 394.42 g/mol. Its IUPAC name is (E)-1-(3,4-dimethoxyphenyl)-3-[5-[(2-methoxyphenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(3,4-dimethoxyphenyl)-3-[5-[(2-methoxyphenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19561030 |
| Molecular Formula | C23H22O6 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | (E)-1-(3,4-dimethoxyphenyl)-3-[5-[(2-methoxyphenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2ccc(COc3ccccc3OC)o2)cc1OC |
| InChI | InChI=1S/C23H22O6/c1-25-20-6-4-5-7-22(20)28-15-18-10-9-17(29-18)11-12-19(24)16-8-13-21(26-2)23(14-16)27-3/h4-14H,15H2,1-3H3/b12-11+ |
| InChIKey | DTMJEMKQUIJEAV-VAWYXSNFSA-N |
| XLogP | 4.78 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|