C21H16ClFO3 — CID 19570987
(E)-3-[5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-yl]-1-(3-methylphenyl)prop-2-en-1-one (PubChem CID 19570987) has the molecular formula C21H16ClFO3 and a molecular weight of 370.81 g/mol. Its IUPAC name is (E)-3-[5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-yl]-1-(3-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-yl]-1-(3-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19570987 |
| Molecular Formula | C21H16ClFO3 |
| Molecular Weight | 370.81 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | (E)-3-[5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-yl]-1-(3-methylphenyl)prop-2-en-1-one |
| SMILES | Cc1cccc(C(=O)/C=C/c2ccc(COc3ccc(F)cc3Cl)o2)c1 |
| InChI | InChI=1S/C21H16ClFO3/c1-14-3-2-4-15(11-14)20(24)9-8-17-6-7-18(26-17)13-25-21-10-5-16(23)12-19(21)22/h2-12H,13H2,1H3/b9-8+ |
| InChIKey | DFOYBMCSVXCREL-CMDGGOBGSA-N |
| XLogP | 5.86 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.81 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|