C21H14F4O4 — CID 19542637
(E)-1-[3-(difluoromethoxy)phenyl]-3-[5-[(2,4-difluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19542637) has the molecular formula C21H14F4O4 and a molecular weight of 406.33 g/mol. Its IUPAC name is (E)-1-[3-(difluoromethoxy)phenyl]-3-[5-[(2,4-difluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-[3-(difluoromethoxy)phenyl]-3-[5-[(2,4-difluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19542637 |
| Molecular Formula | C21H14F4O4 |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | (E)-1-[3-(difluoromethoxy)phenyl]-3-[5-[(2,4-difluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(COc2ccc(F)cc2F)o1)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C21H14F4O4/c22-14-4-9-20(18(23)11-14)27-12-17-6-5-15(28-17)7-8-19(26)13-2-1-3-16(10-13)29-21(24)25/h1-11,21H,12H2/b8-7+ |
| InChIKey | DIHVSBXAKZNROK-BQYQJAHWSA-N |
| XLogP | 5.63 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|