C20H14FNO6 — CID 19562812
(E)-3-[5-[(5-fluoro-2-nitrophenoxy)methyl]furan-2-yl]-1-(3-hydroxyphenyl)prop-2-en-1-one (PubChem CID 19562812) has the molecular formula C20H14FNO6 and a molecular weight of 383.33 g/mol. Its IUPAC name is (E)-3-[5-[(5-fluoro-2-nitrophenoxy)methyl]furan-2-yl]-1-(3-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(5-fluoro-2-nitrophenoxy)methyl]furan-2-yl]-1-(3-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19562812 |
| Molecular Formula | C20H14FNO6 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | (E)-3-[5-[(5-fluoro-2-nitrophenoxy)methyl]furan-2-yl]-1-(3-hydroxyphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(COc2cc(F)ccc2[N+](=O)[O-])o1)c1cccc(O)c1 |
| InChI | InChI=1S/C20H14FNO6/c21-14-4-8-18(22(25)26)20(11-14)27-12-17-6-5-16(28-17)7-9-19(24)13-2-1-3-15(23)10-13/h1-11,23H,12H2/b9-7+ |
| InChIKey | HANWXZFFTGQTGW-VQHVLOKHSA-N |
| XLogP | 4.51 |
| TPSA | 102.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|