C24H16ClNO5 — CID 19561223
(E)-3-[5-[(4-chloro-2-nitrophenoxy)methyl]furan-2-yl]-1-naphthalen-2-ylprop-2-en-1-one (PubChem CID 19561223) has the molecular formula C24H16ClNO5 and a molecular weight of 433.85 g/mol. Its IUPAC name is (E)-3-[5-[(4-chloro-2-nitrophenoxy)methyl]furan-2-yl]-1-naphthalen-2-ylprop-2-en-1-one.
| Compound Name | (E)-3-[5-[(4-chloro-2-nitrophenoxy)methyl]furan-2-yl]-1-naphthalen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 19561223 |
| Molecular Formula | C24H16ClNO5 |
| Molecular Weight | 433.85 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | (E)-3-[5-[(4-chloro-2-nitrophenoxy)methyl]furan-2-yl]-1-naphthalen-2-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(COc2ccc(Cl)cc2[N+](=O)[O-])o1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H16ClNO5/c25-19-7-12-24(22(14-19)26(28)29)30-15-21-9-8-20(31-21)10-11-23(27)18-6-5-16-3-1-2-4-17(16)13-18/h1-14H,15H2/b11-10+ |
| InChIKey | MBTVEHYOFMQSPA-ZHACJKMWSA-N |
| XLogP | 6.47 |
| TPSA | 82.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.85 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|