C20H14ClNO7 — CID 19540700
(E)-3-[5-[(4-chloro-2-nitrophenoxy)methyl]furan-2-yl]-1-(2,4-dihydroxyphenyl)prop-2-en-1-one (PubChem CID 19540700) has the molecular formula C20H14ClNO7 and a molecular weight of 415.79 g/mol. Its IUPAC name is (E)-3-[5-[(4-chloro-2-nitrophenoxy)methyl]furan-2-yl]-1-(2,4-dihydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(4-chloro-2-nitrophenoxy)methyl]furan-2-yl]-1-(2,4-dihydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19540700 |
| Molecular Formula | C20H14ClNO7 |
| Molecular Weight | 415.79 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | (E)-3-[5-[(4-chloro-2-nitrophenoxy)methyl]furan-2-yl]-1-(2,4-dihydroxyphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(COc2ccc(Cl)cc2[N+](=O)[O-])o1)c1ccc(O)cc1O |
| InChI | InChI=1S/C20H14ClNO7/c21-12-1-8-20(17(9-12)22(26)27)28-11-15-4-3-14(29-15)5-7-18(24)16-6-2-13(23)10-19(16)25/h1-10,23,25H,11H2/b7-5+ |
| InChIKey | LLJPAWDZFMHVKS-FNORWQNLSA-N |
| XLogP | 4.73 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.79 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|