C20H13Cl2NO5 — CID 19562610
(E)-3-[5-[(2,3-dichlorophenoxy)methyl]furan-2-yl]-1-(2-nitrophenyl)prop-2-en-1-one (PubChem CID 19562610) has the molecular formula C20H13Cl2NO5 and a molecular weight of 418.23 g/mol. Its IUPAC name is (E)-3-[5-[(2,3-dichlorophenoxy)methyl]furan-2-yl]-1-(2-nitrophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(2,3-dichlorophenoxy)methyl]furan-2-yl]-1-(2-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19562610 |
| Molecular Formula | C20H13Cl2NO5 |
| Molecular Weight | 418.23 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | (E)-3-[5-[(2,3-dichlorophenoxy)methyl]furan-2-yl]-1-(2-nitrophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(COc2cccc(Cl)c2Cl)o1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H13Cl2NO5/c21-16-5-3-7-19(20(16)22)27-12-14-9-8-13(28-14)10-11-18(24)15-4-1-2-6-17(15)23(25)26/h1-11H,12H2/b11-10+ |
| InChIKey | OXXJWVONPUXYED-ZHACJKMWSA-N |
| XLogP | 5.97 |
| TPSA | 82.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.23 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|