C17H14Cl2O3 — CID 19558880
(E)-1-cyclopropyl-3-[5-[(2,3-dichlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19558880) has the molecular formula C17H14Cl2O3 and a molecular weight of 337.20 g/mol. Its IUPAC name is (E)-1-cyclopropyl-3-[5-[(2,3-dichlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-cyclopropyl-3-[5-[(2,3-dichlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19558880 |
| Molecular Formula | C17H14Cl2O3 |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | (E)-1-cyclopropyl-3-[5-[(2,3-dichlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(COc2cccc(Cl)c2Cl)o1)C1CC1 |
| InChI | InChI=1S/C17H14Cl2O3/c18-14-2-1-3-16(17(14)19)21-10-13-7-6-12(22-13)8-9-15(20)11-4-5-11/h1-3,6-9,11H,4-5,10H2/b9-8+ |
| InChIKey | FDDRJHNSTCEOOK-CMDGGOBGSA-N |
| XLogP | 5.16 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|