C18H13Cl3N2O3 — CID 19567338
(E)-1-(4-chloro-1-methylpyrazol-3-yl)-3-[5-[(2,3-dichlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19567338) has the molecular formula C18H13Cl3N2O3 and a molecular weight of 411.67 g/mol. Its IUPAC name is (E)-1-(4-chloro-1-methylpyrazol-3-yl)-3-[5-[(2,3-dichlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-chloro-1-methylpyrazol-3-yl)-3-[5-[(2,3-dichlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19567338 |
| Molecular Formula | C18H13Cl3N2O3 |
| Molecular Weight | 411.67 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | (E)-1-(4-chloro-1-methylpyrazol-3-yl)-3-[5-[(2,3-dichlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | Cn1cc(Cl)c(C(=O)/C=C/c2ccc(COc3cccc(Cl)c3Cl)o2)n1 |
| InChI | InChI=1S/C18H13Cl3N2O3/c1-23-9-14(20)18(22-23)15(24)8-7-11-5-6-12(26-11)10-25-16-4-2-3-13(19)17(16)21/h2-9H,10H2,1H3/b8-7+ |
| InChIKey | XRVIIZCLIKSXMB-BQYQJAHWSA-N |
| XLogP | 5.45 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.67 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|