C19H14ClN3O3 — CID 19567316
4-[[5-[(E)-3-(4-chloro-1-methylpyrazol-3-yl)-3-oxoprop-1-enyl]furan-2-yl]methoxy]benzonitrile (PubChem CID 19567316) has the molecular formula C19H14ClN3O3 and a molecular weight of 367.79 g/mol. Its IUPAC name is 4-[[5-[(E)-3-(4-chloro-1-methylpyrazol-3-yl)-3-oxoprop-1-enyl]furan-2-yl]methoxy]benzonitrile.
| Compound Name | 4-[[5-[(E)-3-(4-chloro-1-methylpyrazol-3-yl)-3-oxoprop-1-enyl]furan-2-yl]methoxy]benzonitrile |
|---|---|
| PubChem CID | 19567316 |
| Molecular Formula | C19H14ClN3O3 |
| Molecular Weight | 367.79 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 4-[[5-[(E)-3-(4-chloro-1-methylpyrazol-3-yl)-3-oxoprop-1-enyl]furan-2-yl]methoxy]benzonitrile |
| SMILES | Cn1cc(Cl)c(C(=O)/C=C/c2ccc(COc3ccc(C#N)cc3)o2)n1 |
| InChI | InChI=1S/C19H14ClN3O3/c1-23-11-17(20)19(22-23)18(24)9-8-15-6-7-16(26-15)12-25-14-4-2-13(10-21)3-5-14/h2-9,11H,12H2,1H3/b9-8+ |
| InChIKey | HZMQSKDFOLCOCO-CMDGGOBGSA-N |
| XLogP | 4.01 |
| TPSA | 81.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.79 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|