C20H14Cl2O4 — CID 19564802
(E)-3-[5-[(3,4-dichlorophenoxy)methyl]furan-2-yl]-1-(4-hydroxyphenyl)prop-2-en-1-one (PubChem CID 19564802) has the molecular formula C20H14Cl2O4 and a molecular weight of 389.23 g/mol. Its IUPAC name is (E)-3-[5-[(3,4-dichlorophenoxy)methyl]furan-2-yl]-1-(4-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(3,4-dichlorophenoxy)methyl]furan-2-yl]-1-(4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19564802 |
| Molecular Formula | C20H14Cl2O4 |
| Molecular Weight | 389.23 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | (E)-3-[5-[(3,4-dichlorophenoxy)methyl]furan-2-yl]-1-(4-hydroxyphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(COc2ccc(Cl)c(Cl)c2)o1)c1ccc(O)cc1 |
| InChI | InChI=1S/C20H14Cl2O4/c21-18-9-7-16(11-19(18)22)25-12-17-6-5-15(26-17)8-10-20(24)13-1-3-14(23)4-2-13/h1-11,23H,12H2/b10-8+ |
| InChIKey | FYMKHUOFBVERJK-CSKARUKUSA-N |
| XLogP | 5.77 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.23 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|