C22H17ClF2O4 — CID 19542824
(E)-3-[5-[(4-chloro-3-methylphenoxy)methyl]furan-2-yl]-1-[4-(difluoromethoxy)phenyl]prop-2-en-1-one (PubChem CID 19542824) has the molecular formula C22H17ClF2O4 and a molecular weight of 418.82 g/mol. Its IUPAC name is (E)-3-[5-[(4-chloro-3-methylphenoxy)methyl]furan-2-yl]-1-[4-(difluoromethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(4-chloro-3-methylphenoxy)methyl]furan-2-yl]-1-[4-(difluoromethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19542824 |
| Molecular Formula | C22H17ClF2O4 |
| Molecular Weight | 418.82 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | (E)-3-[5-[(4-chloro-3-methylphenoxy)methyl]furan-2-yl]-1-[4-(difluoromethoxy)phenyl]prop-2-en-1-one |
| SMILES | Cc1cc(OCc2ccc(/C=C/C(=O)c3ccc(OC(F)F)cc3)o2)ccc1Cl |
| InChI | InChI=1S/C22H17ClF2O4/c1-14-12-18(8-10-20(14)23)27-13-19-7-6-16(28-19)9-11-21(26)15-2-4-17(5-3-15)29-22(24)25/h2-12,22H,13H2,1H3/b11-9+ |
| InChIKey | ADERWXNTDMDNIU-PKNBQFBNSA-N |
| XLogP | 6.32 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.82 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|