C21H15F2NO6 — CID 19542852
(E)-1-[4-(difluoromethoxy)phenyl]-3-[5-[(2-nitrophenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19542852) has the molecular formula C21H15F2NO6 and a molecular weight of 415.35 g/mol. Its IUPAC name is (E)-1-[4-(difluoromethoxy)phenyl]-3-[5-[(2-nitrophenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-(difluoromethoxy)phenyl]-3-[5-[(2-nitrophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19542852 |
| Molecular Formula | C21H15F2NO6 |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | (E)-1-[4-(difluoromethoxy)phenyl]-3-[5-[(2-nitrophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(COc2ccccc2[N+](=O)[O-])o1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C21H15F2NO6/c22-21(23)30-16-7-5-14(6-8-16)19(25)12-11-15-9-10-17(29-15)13-28-20-4-2-1-3-18(20)24(26)27/h1-12,21H,13H2/b12-11+ |
| InChIKey | PKLZZOJOLQHKQQ-VAWYXSNFSA-N |
| XLogP | 5.26 |
| TPSA | 91.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|