C18H12BrNO5S — CID 19569539
(E)-1-(4-bromothiophen-2-yl)-3-[5-[(2-nitrophenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19569539) has the molecular formula C18H12BrNO5S and a molecular weight of 434.27 g/mol. Its IUPAC name is (E)-1-(4-bromothiophen-2-yl)-3-[5-[(2-nitrophenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-bromothiophen-2-yl)-3-[5-[(2-nitrophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19569539 |
| Molecular Formula | C18H12BrNO5S |
| Molecular Weight | 434.27 g/mol |
| Exact Mass | 432.96 |
| IUPAC Name | (E)-1-(4-bromothiophen-2-yl)-3-[5-[(2-nitrophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(COc2ccccc2[N+](=O)[O-])o1)c1cc(Br)cs1 |
| InChI | InChI=1S/C18H12BrNO5S/c19-12-9-18(26-11-12)16(21)8-7-13-5-6-14(25-13)10-24-17-4-2-1-3-15(17)20(22)23/h1-9,11H,10H2/b8-7+ |
| InChIKey | YQYUAEAGNZWJKZ-BQYQJAHWSA-N |
| XLogP | 5.49 |
| TPSA | 82.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.27 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|