C20H17BrO3S — CID 19569614
(E)-1-(4-bromothiophen-2-yl)-3-[5-[(4-ethylphenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19569614) has the molecular formula C20H17BrO3S and a molecular weight of 417.32 g/mol. Its IUPAC name is (E)-1-(4-bromothiophen-2-yl)-3-[5-[(4-ethylphenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-bromothiophen-2-yl)-3-[5-[(4-ethylphenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19569614 |
| Molecular Formula | C20H17BrO3S |
| Molecular Weight | 417.32 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | (E)-1-(4-bromothiophen-2-yl)-3-[5-[(4-ethylphenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | CCc1ccc(OCc2ccc(/C=C/C(=O)c3cc(Br)cs3)o2)cc1 |
| InChI | InChI=1S/C20H17BrO3S/c1-2-14-3-5-16(6-4-14)23-12-18-8-7-17(24-18)9-10-19(22)20-11-15(21)13-25-20/h3-11,13H,2,12H2,1H3/b10-9+ |
| InChIKey | NJVOIWMTIPEDFO-MDZDMXLPSA-N |
| XLogP | 6.14 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.32 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|