C21H19BrO3S — CID 19545007
(E)-1-(4-bromo-5-propylthiophen-2-yl)-3-[5-(phenoxymethyl)furan-2-yl]prop-2-en-1-one (PubChem CID 19545007) has the molecular formula C21H19BrO3S and a molecular weight of 431.35 g/mol. Its IUPAC name is (E)-1-(4-bromo-5-propylthiophen-2-yl)-3-[5-(phenoxymethyl)furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-bromo-5-propylthiophen-2-yl)-3-[5-(phenoxymethyl)furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19545007 |
| Molecular Formula | C21H19BrO3S |
| Molecular Weight | 431.35 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | (E)-1-(4-bromo-5-propylthiophen-2-yl)-3-[5-(phenoxymethyl)furan-2-yl]prop-2-en-1-one |
| SMILES | CCCc1sc(C(=O)/C=C/c2ccc(COc3ccccc3)o2)cc1Br |
| InChI | InChI=1S/C21H19BrO3S/c1-2-6-20-18(22)13-21(26-20)19(23)12-11-16-9-10-17(25-16)14-24-15-7-4-3-5-8-15/h3-5,7-13H,2,6,14H2,1H3/b12-11+ |
| InChIKey | RWRAETDORXAXCH-VAWYXSNFSA-N |
| XLogP | 6.53 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.35 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|