C21H17BrCl2O3S — CID 19544925
(E)-1-(4-bromo-5-propylthiophen-2-yl)-3-[5-[(2,4-dichlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19544925) has the molecular formula C21H17BrCl2O3S and a molecular weight of 500.24 g/mol. Its IUPAC name is (E)-1-(4-bromo-5-propylthiophen-2-yl)-3-[5-[(2,4-dichlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-bromo-5-propylthiophen-2-yl)-3-[5-[(2,4-dichlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19544925 |
| Molecular Formula | C21H17BrCl2O3S |
| Molecular Weight | 500.24 g/mol |
| Exact Mass | 497.95 |
| IUPAC Name | (E)-1-(4-bromo-5-propylthiophen-2-yl)-3-[5-[(2,4-dichlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | CCCc1sc(C(=O)/C=C/c2ccc(COc3ccc(Cl)cc3Cl)o2)cc1Br |
| InChI | InChI=1S/C21H17BrCl2O3S/c1-2-3-20-16(22)11-21(28-20)18(25)8-7-14-5-6-15(27-14)12-26-19-9-4-13(23)10-17(19)24/h4-11H,2-3,12H2,1H3/b8-7+ |
| InChIKey | KQANBXQJTWKQPF-BQYQJAHWSA-N |
| XLogP | 7.84 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.24 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|