C19H13Cl3O3S — CID 19555103
(E)-1-(5-methylthiophen-2-yl)-3-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19555103) has the molecular formula C19H13Cl3O3S and a molecular weight of 427.74 g/mol. Its IUPAC name is (E)-1-(5-methylthiophen-2-yl)-3-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(5-methylthiophen-2-yl)-3-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19555103 |
| Molecular Formula | C19H13Cl3O3S |
| Molecular Weight | 427.74 g/mol |
| Exact Mass | 425.97 |
| IUPAC Name | (E)-1-(5-methylthiophen-2-yl)-3-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | Cc1ccc(C(=O)/C=C/c2ccc(COc3c(Cl)cc(Cl)cc3Cl)o2)s1 |
| InChI | InChI=1S/C19H13Cl3O3S/c1-11-2-7-18(26-11)17(23)6-5-13-3-4-14(25-13)10-24-19-15(21)8-12(20)9-16(19)22/h2-9H,10H2,1H3/b6-5+ |
| InChIKey | ORKMMTQHISVARO-AATRIKPKSA-N |
| XLogP | 7.08 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.74 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|