C20H15NO3S — CID 19555117
4-[[5-[(E)-3-(5-methylthiophen-2-yl)-3-oxoprop-1-enyl]furan-2-yl]methoxy]benzonitrile (PubChem CID 19555117) has the molecular formula C20H15NO3S and a molecular weight of 349.41 g/mol. Its IUPAC name is 4-[[5-[(E)-3-(5-methylthiophen-2-yl)-3-oxoprop-1-enyl]furan-2-yl]methoxy]benzonitrile.
| Compound Name | 4-[[5-[(E)-3-(5-methylthiophen-2-yl)-3-oxoprop-1-enyl]furan-2-yl]methoxy]benzonitrile |
|---|---|
| PubChem CID | 19555117 |
| Molecular Formula | C20H15NO3S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 4-[[5-[(E)-3-(5-methylthiophen-2-yl)-3-oxoprop-1-enyl]furan-2-yl]methoxy]benzonitrile |
| SMILES | Cc1ccc(C(=O)/C=C/c2ccc(COc3ccc(C#N)cc3)o2)s1 |
| InChI | InChI=1S/C20H15NO3S/c1-14-2-11-20(25-14)19(22)10-9-17-7-8-18(24-17)13-23-16-5-3-15(12-21)4-6-16/h2-11H,13H2,1H3/b10-9+ |
| InChIKey | ALSVLXMKUIADNB-MDZDMXLPSA-N |
| XLogP | 5.00 |
| TPSA | 63.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|