C20H17FO3S — CID 19556929
(E)-1-(2,5-dimethylthiophen-3-yl)-3-[5-[(4-fluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19556929) has the molecular formula C20H17FO3S and a molecular weight of 356.42 g/mol. Its IUPAC name is (E)-1-(2,5-dimethylthiophen-3-yl)-3-[5-[(4-fluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(2,5-dimethylthiophen-3-yl)-3-[5-[(4-fluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19556929 |
| Molecular Formula | C20H17FO3S |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | (E)-1-(2,5-dimethylthiophen-3-yl)-3-[5-[(4-fluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | Cc1cc(C(=O)/C=C/c2ccc(COc3ccc(F)cc3)o2)c(C)s1 |
| InChI | InChI=1S/C20H17FO3S/c1-13-11-19(14(2)25-13)20(22)10-9-17-7-8-18(24-17)12-23-16-5-3-15(21)4-6-16/h3-11H,12H2,1-2H3/b10-9+ |
| InChIKey | CMHFCFFSNRZYFA-MDZDMXLPSA-N |
| XLogP | 5.57 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|