C20H17BrO3S — CID 19556906
(E)-3-[5-[(2-bromophenoxy)methyl]furan-2-yl]-1-(2,5-dimethylthiophen-3-yl)prop-2-en-1-one (PubChem CID 19556906) has the molecular formula C20H17BrO3S and a molecular weight of 417.32 g/mol. Its IUPAC name is (E)-3-[5-[(2-bromophenoxy)methyl]furan-2-yl]-1-(2,5-dimethylthiophen-3-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(2-bromophenoxy)methyl]furan-2-yl]-1-(2,5-dimethylthiophen-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19556906 |
| Molecular Formula | C20H17BrO3S |
| Molecular Weight | 417.32 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | (E)-3-[5-[(2-bromophenoxy)methyl]furan-2-yl]-1-(2,5-dimethylthiophen-3-yl)prop-2-en-1-one |
| SMILES | Cc1cc(C(=O)/C=C/c2ccc(COc3ccccc3Br)o2)c(C)s1 |
| InChI | InChI=1S/C20H17BrO3S/c1-13-11-17(14(2)25-13)19(22)10-9-15-7-8-16(24-15)12-23-20-6-4-3-5-18(20)21/h3-11H,12H2,1-2H3/b10-9+ |
| InChIKey | ROVBHLRJARBLKH-MDZDMXLPSA-N |
| XLogP | 6.20 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.32 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|