C20H13BrCl2O3 — CID 19569160
(E)-3-[5-[(2-bromophenoxy)methyl]furan-2-yl]-1-(3,4-dichlorophenyl)prop-2-en-1-one (PubChem CID 19569160) has the molecular formula C20H13BrCl2O3 and a molecular weight of 452.13 g/mol. Its IUPAC name is (E)-3-[5-[(2-bromophenoxy)methyl]furan-2-yl]-1-(3,4-dichlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(2-bromophenoxy)methyl]furan-2-yl]-1-(3,4-dichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19569160 |
| Molecular Formula | C20H13BrCl2O3 |
| Molecular Weight | 452.13 g/mol |
| Exact Mass | 449.94 |
| IUPAC Name | (E)-3-[5-[(2-bromophenoxy)methyl]furan-2-yl]-1-(3,4-dichlorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(COc2ccccc2Br)o1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H13BrCl2O3/c21-16-3-1-2-4-20(16)25-12-15-7-6-14(26-15)8-10-19(24)13-5-9-17(22)18(23)11-13/h1-11H,12H2/b10-8+ |
| InChIKey | JHKCNBCTGABIOG-CSKARUKUSA-N |
| XLogP | 6.82 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.13 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|