C23H24O3S — CID 19545202
(E)-3-[5-[(4-ethylphenoxy)methyl]furan-2-yl]-1-(5-propylthiophen-2-yl)prop-2-en-1-one (PubChem CID 19545202) has the molecular formula C23H24O3S and a molecular weight of 380.51 g/mol. Its IUPAC name is (E)-3-[5-[(4-ethylphenoxy)methyl]furan-2-yl]-1-(5-propylthiophen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(4-ethylphenoxy)methyl]furan-2-yl]-1-(5-propylthiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19545202 |
| Molecular Formula | C23H24O3S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | (E)-3-[5-[(4-ethylphenoxy)methyl]furan-2-yl]-1-(5-propylthiophen-2-yl)prop-2-en-1-one |
| SMILES | CCCc1ccc(C(=O)/C=C/c2ccc(COc3ccc(CC)cc3)o2)s1 |
| InChI | InChI=1S/C23H24O3S/c1-3-5-21-13-15-23(27-21)22(24)14-12-19-10-11-20(26-19)16-25-18-8-6-17(4-2)7-9-18/h6-15H,3-5,16H2,1-2H3/b14-12+ |
| InChIKey | GMOADOWYUIABFB-WYMLVPIESA-N |
| XLogP | 6.33 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|