C25H19BrO3S — CID 19561428
(E)-1-(5-benzylthiophen-2-yl)-3-[5-[(3-bromophenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19561428) has the molecular formula C25H19BrO3S and a molecular weight of 479.40 g/mol. Its IUPAC name is (E)-1-(5-benzylthiophen-2-yl)-3-[5-[(3-bromophenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(5-benzylthiophen-2-yl)-3-[5-[(3-bromophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19561428 |
| Molecular Formula | C25H19BrO3S |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | (E)-1-(5-benzylthiophen-2-yl)-3-[5-[(3-bromophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(COc2cccc(Br)c2)o1)c1ccc(Cc2ccccc2)s1 |
| InChI | InChI=1S/C25H19BrO3S/c26-19-7-4-8-21(16-19)28-17-22-10-9-20(29-22)11-13-24(27)25-14-12-23(30-25)15-18-5-2-1-3-6-18/h1-14,16H,15,17H2/b13-11+ |
| InChIKey | FHDZAIDADCYRDW-ACCUITESSA-N |
| XLogP | 7.17 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|