C25H18ClFO3S — CID 19561435
(E)-1-(5-benzylthiophen-2-yl)-3-[5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19561435) has the molecular formula C25H18ClFO3S and a molecular weight of 452.93 g/mol. Its IUPAC name is (E)-1-(5-benzylthiophen-2-yl)-3-[5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(5-benzylthiophen-2-yl)-3-[5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19561435 |
| Molecular Formula | C25H18ClFO3S |
| Molecular Weight | 452.93 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | (E)-1-(5-benzylthiophen-2-yl)-3-[5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(COc2ccc(F)cc2Cl)o1)c1ccc(Cc2ccccc2)s1 |
| InChI | InChI=1S/C25H18ClFO3S/c26-22-15-18(27)6-12-24(22)29-16-20-8-7-19(30-20)9-11-23(28)25-13-10-21(31-25)14-17-4-2-1-3-5-17/h1-13,15H,14,16H2/b11-9+ |
| InChIKey | DFEVHUMAFAQKGP-PKNBQFBNSA-N |
| XLogP | 7.20 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.93 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|