C24H21ClFNO4 — CID 19541521
(E)-3-[5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-yl]-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one (PubChem CID 19541521) has the molecular formula C24H21ClFNO4 and a molecular weight of 441.89 g/mol. Its IUPAC name is (E)-3-[5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-yl]-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-yl]-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19541521 |
| Molecular Formula | C24H21ClFNO4 |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | (E)-3-[5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-yl]-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(COc2ccc(F)cc2Cl)o1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H21ClFNO4/c25-22-15-18(26)3-10-24(22)30-16-21-7-6-20(31-21)8-9-23(28)17-1-4-19(5-2-17)27-11-13-29-14-12-27/h1-10,15H,11-14,16H2/b9-8+ |
| InChIKey | OMVZZJKSZKHWHU-CMDGGOBGSA-N |
| XLogP | 5.38 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|