C20H14ClFO5 — CID 19540697
(E)-3-[5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-yl]-1-(2,4-dihydroxyphenyl)prop-2-en-1-one (PubChem CID 19540697) has the molecular formula C20H14ClFO5 and a molecular weight of 388.78 g/mol. Its IUPAC name is (E)-3-[5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-yl]-1-(2,4-dihydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-yl]-1-(2,4-dihydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19540697 |
| Molecular Formula | C20H14ClFO5 |
| Molecular Weight | 388.78 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | (E)-3-[5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-yl]-1-(2,4-dihydroxyphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(COc2ccc(F)cc2Cl)o1)c1ccc(O)cc1O |
| InChI | InChI=1S/C20H14ClFO5/c21-17-9-12(22)1-8-20(17)26-11-15-4-3-14(27-15)5-7-18(24)16-6-2-13(23)10-19(16)25/h1-10,23,25H,11H2/b7-5+ |
| InChIKey | WEGDGOFEKASVNF-FNORWQNLSA-N |
| XLogP | 4.96 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.78 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|