C20H12Cl4O3 — CID 19563009
(E)-3-[5-[(2,3-dichlorophenoxy)methyl]furan-2-yl]-1-(2,4-dichlorophenyl)prop-2-en-1-one (PubChem CID 19563009) has the molecular formula C20H12Cl4O3 and a molecular weight of 442.13 g/mol. Its IUPAC name is (E)-3-[5-[(2,3-dichlorophenoxy)methyl]furan-2-yl]-1-(2,4-dichlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(2,3-dichlorophenoxy)methyl]furan-2-yl]-1-(2,4-dichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19563009 |
| Molecular Formula | C20H12Cl4O3 |
| Molecular Weight | 442.13 g/mol |
| Exact Mass | 439.95 |
| IUPAC Name | (E)-3-[5-[(2,3-dichlorophenoxy)methyl]furan-2-yl]-1-(2,4-dichlorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(COc2cccc(Cl)c2Cl)o1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H12Cl4O3/c21-12-4-8-15(17(23)10-12)18(25)9-7-13-5-6-14(27-13)11-26-19-3-1-2-16(22)20(19)24/h1-10H,11H2/b9-7+ |
| InChIKey | UTCAVLQJBIIKPN-VQHVLOKHSA-N |
| XLogP | 7.37 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.13 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|