C22H18Cl2O5 — CID 19561034
(E)-3-[5-[(2,3-dichlorophenoxy)methyl]furan-2-yl]-1-(3,4-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 19561034) has the molecular formula C22H18Cl2O5 and a molecular weight of 433.29 g/mol. Its IUPAC name is (E)-3-[5-[(2,3-dichlorophenoxy)methyl]furan-2-yl]-1-(3,4-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(2,3-dichlorophenoxy)methyl]furan-2-yl]-1-(3,4-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19561034 |
| Molecular Formula | C22H18Cl2O5 |
| Molecular Weight | 433.29 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | (E)-3-[5-[(2,3-dichlorophenoxy)methyl]furan-2-yl]-1-(3,4-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2ccc(COc3cccc(Cl)c3Cl)o2)cc1OC |
| InChI | InChI=1S/C22H18Cl2O5/c1-26-19-11-6-14(12-21(19)27-2)18(25)10-9-15-7-8-16(29-15)13-28-20-5-3-4-17(23)22(20)24/h3-12H,13H2,1-2H3/b10-9+ |
| InChIKey | RXVUZRDIAZQYJW-MDZDMXLPSA-N |
| XLogP | 6.08 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.29 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|