C22H18F2O5 — CID 19542645
(E)-1-[3-(difluoromethoxy)phenyl]-3-[5-[(2-methoxyphenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19542645) has the molecular formula C22H18F2O5 and a molecular weight of 400.38 g/mol. Its IUPAC name is (E)-1-[3-(difluoromethoxy)phenyl]-3-[5-[(2-methoxyphenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-[3-(difluoromethoxy)phenyl]-3-[5-[(2-methoxyphenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19542645 |
| Molecular Formula | C22H18F2O5 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | (E)-1-[3-(difluoromethoxy)phenyl]-3-[5-[(2-methoxyphenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | COc1ccccc1OCc1ccc(/C=C/C(=O)c2cccc(OC(F)F)c2)o1 |
| InChI | InChI=1S/C22H18F2O5/c1-26-20-7-2-3-8-21(20)27-14-18-10-9-16(28-18)11-12-19(25)15-5-4-6-17(13-15)29-22(23)24/h2-13,22H,14H2,1H3/b12-11+ |
| InChIKey | DOQYJGWDQUTFBB-VAWYXSNFSA-N |
| XLogP | 5.36 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|