C25H21NO4 — CID 19559055
(E)-3-[5-[(2-methoxyphenoxy)methyl]furan-2-yl]-1-(4-pyrrol-1-ylphenyl)prop-2-en-1-one (PubChem CID 19559055) has the molecular formula C25H21NO4 and a molecular weight of 399.45 g/mol. Its IUPAC name is (E)-3-[5-[(2-methoxyphenoxy)methyl]furan-2-yl]-1-(4-pyrrol-1-ylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(2-methoxyphenoxy)methyl]furan-2-yl]-1-(4-pyrrol-1-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19559055 |
| Molecular Formula | C25H21NO4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | (E)-3-[5-[(2-methoxyphenoxy)methyl]furan-2-yl]-1-(4-pyrrol-1-ylphenyl)prop-2-en-1-one |
| SMILES | COc1ccccc1OCc1ccc(/C=C/C(=O)c2ccc(-n3cccc3)cc2)o1 |
| InChI | InChI=1S/C25H21NO4/c1-28-24-6-2-3-7-25(24)29-18-22-13-12-21(30-22)14-15-23(27)19-8-10-20(11-9-19)26-16-4-5-17-26/h2-17H,18H2,1H3/b15-14+ |
| InChIKey | MJDSOXKLYORXCA-CCEZHUSRSA-N |
| XLogP | 5.55 |
| TPSA | 53.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|