C18H16BrClOS — CID 19544992
(2E,4Z)-1-(4-bromo-5-propylthiophen-2-yl)-4-chloro-5-phenylpenta-2,4-dien-1-one (PubChem CID 19544992) has the molecular formula C18H16BrClOS and a molecular weight of 395.75 g/mol. Its IUPAC name is (2E,4Z)-1-(4-bromo-5-propylthiophen-2-yl)-4-chloro-5-phenylpenta-2,4-dien-1-one.
| Compound Name | (2E,4Z)-1-(4-bromo-5-propylthiophen-2-yl)-4-chloro-5-phenylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 19544992 |
| Molecular Formula | C18H16BrClOS |
| Molecular Weight | 395.75 g/mol |
| Exact Mass | 393.98 |
| IUPAC Name | (2E,4Z)-1-(4-bromo-5-propylthiophen-2-yl)-4-chloro-5-phenylpenta-2,4-dien-1-one |
| SMILES | CCCc1sc(C(=O)/C=C/C(Cl)=C/c2ccccc2)cc1Br |
| InChI | InChI=1S/C18H16BrClOS/c1-2-6-17-15(19)12-18(22-17)16(21)10-9-14(20)11-13-7-4-3-5-8-13/h3-5,7-12H,2,6H2,1H3/b10-9+,14-11- |
| InChIKey | SZWNKCQPXHVKAK-POLRJCGMSA-N |
| XLogP | 6.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.75 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|