C14H12Br2OS2 — CID 19544928
(E)-1-(4-bromo-5-propylthiophen-2-yl)-3-(4-bromothiophen-2-yl)prop-2-en-1-one (PubChem CID 19544928) has the molecular formula C14H12Br2OS2 and a molecular weight of 420.19 g/mol. Its IUPAC name is (E)-1-(4-bromo-5-propylthiophen-2-yl)-3-(4-bromothiophen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-bromo-5-propylthiophen-2-yl)-3-(4-bromothiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19544928 |
| Molecular Formula | C14H12Br2OS2 |
| Molecular Weight | 420.19 g/mol |
| Exact Mass | 417.87 |
| IUPAC Name | (E)-1-(4-bromo-5-propylthiophen-2-yl)-3-(4-bromothiophen-2-yl)prop-2-en-1-one |
| SMILES | CCCc1sc(C(=O)/C=C/c2cc(Br)cs2)cc1Br |
| InChI | InChI=1S/C14H12Br2OS2/c1-2-3-13-11(16)7-14(19-13)12(17)5-4-10-6-9(15)8-18-10/h4-8H,2-3H2,1H3/b5-4+ |
| InChIKey | ZCZNVOZONSIZHW-SNAWJCMRSA-N |
| XLogP | 6.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.19 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|