C10H12BrNO3S2 — CID 71987845
3-(4-bromothiophen-2-yl)-N-propylsulfonylprop-2-enamide (PubChem CID 71987845) has the molecular formula C10H12BrNO3S2 and a molecular weight of 338.25 g/mol. Its IUPAC name is 3-(4-bromothiophen-2-yl)-N-propylsulfonylprop-2-enamide.
| Compound Name | 3-(4-bromothiophen-2-yl)-N-propylsulfonylprop-2-enamide |
|---|---|
| PubChem CID | 71987845 |
| Molecular Formula | C10H12BrNO3S2 |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 336.94 |
| IUPAC Name | 3-(4-bromothiophen-2-yl)-N-propylsulfonylprop-2-enamide |
| SMILES | CCCS(=O)(=O)NC(=O)C=Cc1cc(Br)cs1 |
| InChI | InChI=1S/C10H12BrNO3S2/c1-2-5-17(14,15)12-10(13)4-3-9-6-8(11)7-16-9/h3-4,6-7H,2,5H2,1H3,(H,12,13) |
| InChIKey | VZZZPMXZSASBEF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|