C13H8BrF2NOS — CID 68711741
3-(4-bromothiophen-2-yl)-N-(2,3-difluorophenyl)prop-2-enamide (PubChem CID 68711741) has the molecular formula C13H8BrF2NOS and a molecular weight of 344.18 g/mol. Its IUPAC name is 3-(4-bromothiophen-2-yl)-N-(2,3-difluorophenyl)prop-2-enamide.
| Compound Name | 3-(4-bromothiophen-2-yl)-N-(2,3-difluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 68711741 |
| Molecular Formula | C13H8BrF2NOS |
| Molecular Weight | 344.18 g/mol |
| Exact Mass | 342.95 |
| IUPAC Name | 3-(4-bromothiophen-2-yl)-N-(2,3-difluorophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1cc(Br)cs1)Nc1cccc(F)c1F |
| InChI | InChI=1S/C13H8BrF2NOS/c14-8-6-9(19-7-8)4-5-12(18)17-11-3-1-2-10(15)13(11)16/h1-7H,(H,17,18) |
| InChIKey | NURABCVBDHVEBY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.18 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|