C18H12F2N2OS — CID 59149613
(E)-N-(2,3-difluorophenyl)-3-(4-pyridin-3-ylthiophen-2-yl)prop-2-enamide (PubChem CID 59149613) has the molecular formula C18H12F2N2OS and a molecular weight of 342.37 g/mol. Its IUPAC name is (E)-N-(2,3-difluorophenyl)-3-(4-pyridin-3-ylthiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-N-(2,3-difluorophenyl)-3-(4-pyridin-3-ylthiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 59149613 |
| Molecular Formula | C18H12F2N2OS |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | (E)-N-(2,3-difluorophenyl)-3-(4-pyridin-3-ylthiophen-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(-c2cccnc2)cs1)Nc1cccc(F)c1F |
| InChI | InChI=1S/C18H12F2N2OS/c19-15-4-1-5-16(18(15)20)22-17(23)7-6-14-9-13(11-24-14)12-3-2-8-21-10-12/h1-11H,(H,22,23)/b7-6+ |
| InChIKey | CWYDPVVASWKQIA-VOTSOKGWSA-N |
| XLogP | 4.74 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|