C23H23NOS — CID 45051002
(E)-N-(2,6-diethylphenyl)-3-(4-phenylthiophen-2-yl)prop-2-enamide (PubChem CID 45051002) has the molecular formula C23H23NOS and a molecular weight of 361.51 g/mol. Its IUPAC name is (E)-N-(2,6-diethylphenyl)-3-(4-phenylthiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-N-(2,6-diethylphenyl)-3-(4-phenylthiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 45051002 |
| Molecular Formula | C23H23NOS |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | (E)-N-(2,6-diethylphenyl)-3-(4-phenylthiophen-2-yl)prop-2-enamide |
| SMILES | CCc1cccc(CC)c1NC(=O)/C=C/c1cc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C23H23NOS/c1-3-17-11-8-12-18(4-2)23(17)24-22(25)14-13-21-15-20(16-26-21)19-9-6-5-7-10-19/h5-16H,3-4H2,1-2H3,(H,24,25)/b14-13+ |
| InChIKey | AGIZPFARGYNWFL-BUHFOSPRSA-N |
| XLogP | 6.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|