C25H19ClO3 — CID 19561186
(E)-3-[5-[(4-chloro-3-methylphenoxy)methyl]furan-2-yl]-1-naphthalen-2-ylprop-2-en-1-one (PubChem CID 19561186) has the molecular formula C25H19ClO3 and a molecular weight of 402.88 g/mol. Its IUPAC name is (E)-3-[5-[(4-chloro-3-methylphenoxy)methyl]furan-2-yl]-1-naphthalen-2-ylprop-2-en-1-one.
| Compound Name | (E)-3-[5-[(4-chloro-3-methylphenoxy)methyl]furan-2-yl]-1-naphthalen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 19561186 |
| Molecular Formula | C25H19ClO3 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | (E)-3-[5-[(4-chloro-3-methylphenoxy)methyl]furan-2-yl]-1-naphthalen-2-ylprop-2-en-1-one |
| SMILES | Cc1cc(OCc2ccc(/C=C/C(=O)c3ccc4ccccc4c3)o2)ccc1Cl |
| InChI | InChI=1S/C25H19ClO3/c1-17-14-22(10-12-24(17)26)28-16-23-9-8-21(29-23)11-13-25(27)20-7-6-18-4-2-3-5-19(18)15-20/h2-15H,16H2,1H3/b13-11+ |
| InChIKey | JGUPIOJWZZUWCD-ACCUITESSA-N |
| XLogP | 6.87 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|