C23H22O4 — CID 19562815
(E)-1-(3-hydroxyphenyl)-3-[5-[(4-propan-2-ylphenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19562815) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is (E)-1-(3-hydroxyphenyl)-3-[5-[(4-propan-2-ylphenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(3-hydroxyphenyl)-3-[5-[(4-propan-2-ylphenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19562815 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | (E)-1-(3-hydroxyphenyl)-3-[5-[(4-propan-2-ylphenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | CC(C)c1ccc(OCc2ccc(/C=C/C(=O)c3cccc(O)c3)o2)cc1 |
| InChI | InChI=1S/C23H22O4/c1-16(2)17-6-8-20(9-7-17)26-15-22-11-10-21(27-22)12-13-23(25)18-4-3-5-19(24)14-18/h3-14,16,24H,15H2,1-2H3/b13-12+ |
| InChIKey | ZUVKILFCTRXALL-OUKQBFOZSA-N |
| XLogP | 5.58 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|