C24H23ClO3 — CID 19557344
(E)-3-[5-[(2-chloro-6-methylphenoxy)methyl]furan-2-yl]-1-(4-propan-2-ylphenyl)prop-2-en-1-one (PubChem CID 19557344) has the molecular formula C24H23ClO3 and a molecular weight of 394.90 g/mol. Its IUPAC name is (E)-3-[5-[(2-chloro-6-methylphenoxy)methyl]furan-2-yl]-1-(4-propan-2-ylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(2-chloro-6-methylphenoxy)methyl]furan-2-yl]-1-(4-propan-2-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19557344 |
| Molecular Formula | C24H23ClO3 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | (E)-3-[5-[(2-chloro-6-methylphenoxy)methyl]furan-2-yl]-1-(4-propan-2-ylphenyl)prop-2-en-1-one |
| SMILES | Cc1cccc(Cl)c1OCc1ccc(/C=C/C(=O)c2ccc(C(C)C)cc2)o1 |
| InChI | InChI=1S/C24H23ClO3/c1-16(2)18-7-9-19(10-8-18)23(26)14-13-20-11-12-21(28-20)15-27-24-17(3)5-4-6-22(24)25/h4-14,16H,15H2,1-3H3/b14-13+ |
| InChIKey | VCPWUQVWWSQQPE-BUHFOSPRSA-N |
| XLogP | 6.84 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|