C22H16ClNO7 — CID 19556713
(E)-3-[5-[(4-chloro-2-nitrophenoxy)methyl]furan-2-yl]-1-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-en-1-one (PubChem CID 19556713) has the molecular formula C22H16ClNO7 and a molecular weight of 441.82 g/mol. Its IUPAC name is (E)-3-[5-[(4-chloro-2-nitrophenoxy)methyl]furan-2-yl]-1-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(4-chloro-2-nitrophenoxy)methyl]furan-2-yl]-1-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19556713 |
| Molecular Formula | C22H16ClNO7 |
| Molecular Weight | 441.82 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | (E)-3-[5-[(4-chloro-2-nitrophenoxy)methyl]furan-2-yl]-1-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(COc2ccc(Cl)cc2[N+](=O)[O-])o1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C22H16ClNO7/c23-15-2-8-20(18(12-15)24(26)27)30-13-17-4-3-16(31-17)5-6-19(25)14-1-7-21-22(11-14)29-10-9-28-21/h1-8,11-12H,9-10,13H2/b6-5+ |
| InChIKey | PKACVPGUSWUZDJ-AATRIKPKSA-N |
| XLogP | 5.09 |
| TPSA | 101.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.82 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|