C21H15Br3O4 — CID 19558685
(E)-1-(4-methoxyphenyl)-3-[5-[(2,4,6-tribromophenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19558685) has the molecular formula C21H15Br3O4 and a molecular weight of 571.06 g/mol. Its IUPAC name is (E)-1-(4-methoxyphenyl)-3-[5-[(2,4,6-tribromophenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-methoxyphenyl)-3-[5-[(2,4,6-tribromophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19558685 |
| Molecular Formula | C21H15Br3O4 |
| Molecular Weight | 571.06 g/mol |
| Exact Mass | 567.85 |
| IUPAC Name | (E)-1-(4-methoxyphenyl)-3-[5-[(2,4,6-tribromophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2ccc(COc3c(Br)cc(Br)cc3Br)o2)cc1 |
| InChI | InChI=1S/C21H15Br3O4/c1-26-15-4-2-13(3-5-15)20(25)9-8-16-6-7-17(28-16)12-27-21-18(23)10-14(22)11-19(21)24/h2-11H,12H2,1H3/b9-8+ |
| InChIKey | IBMZLPWGVMGRRO-CMDGGOBGSA-N |
| XLogP | 7.05 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.06 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|