C21H18O2S2 — CID 19544627
(E)-3-[3-methoxy-4-(phenylsulfanylmethyl)phenyl]-1-thiophen-2-ylprop-2-en-1-one (PubChem CID 19544627) has the molecular formula C21H18O2S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is (E)-3-[3-methoxy-4-(phenylsulfanylmethyl)phenyl]-1-thiophen-2-ylprop-2-en-1-one.
| Compound Name | (E)-3-[3-methoxy-4-(phenylsulfanylmethyl)phenyl]-1-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 19544627 |
| Molecular Formula | C21H18O2S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | (E)-3-[3-methoxy-4-(phenylsulfanylmethyl)phenyl]-1-thiophen-2-ylprop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2cccs2)ccc1CSc1ccccc1 |
| InChI | InChI=1S/C21H18O2S2/c1-23-20-14-16(10-12-19(22)21-8-5-13-24-21)9-11-17(20)15-25-18-6-3-2-4-7-18/h2-14H,15H2,1H3/b12-10+ |
| InChIKey | XNGNPQATIGSFDG-ZRDIBKRKSA-N |
| XLogP | 5.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|