C28H31ClO3 — CID 19571249
(E)-1-(1-adamantyl)-3-[3-[(2-chloro-4-methylphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one (PubChem CID 19571249) has the molecular formula C28H31ClO3 and a molecular weight of 451.01 g/mol. Its IUPAC name is (E)-1-(1-adamantyl)-3-[3-[(2-chloro-4-methylphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(1-adamantyl)-3-[3-[(2-chloro-4-methylphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19571249 |
| Molecular Formula | C28H31ClO3 |
| Molecular Weight | 451.01 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | (E)-1-(1-adamantyl)-3-[3-[(2-chloro-4-methylphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)C23CC4CC(CC(C4)C2)C3)cc1COc1ccc(C)cc1Cl |
| InChI | InChI=1S/C28H31ClO3/c1-18-3-6-26(24(29)9-18)32-17-23-13-19(4-7-25(23)31-2)5-8-27(30)28-14-20-10-21(15-28)12-22(11-20)16-28/h3-9,13,20-22H,10-12,14-17H2,1-2H3/b8-5+ |
| InChIKey | HPLYGPBQIWSGLH-VMPITWQZSA-N |
| XLogP | 7.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.01 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|