C22H28O3 — CID 167771098
(E)-1-(1-adamantyl)-3-(4-ethoxy-3-methoxyphenyl)prop-2-en-1-one (PubChem CID 167771098) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is (E)-1-(1-adamantyl)-3-(4-ethoxy-3-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(1-adamantyl)-3-(4-ethoxy-3-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 167771098 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (E)-1-(1-adamantyl)-3-(4-ethoxy-3-methoxyphenyl)prop-2-en-1-one |
| SMILES | CCOc1ccc(/C=C/C(=O)C23CC4CC(CC(C4)C2)C3)cc1OC |
| InChI | InChI=1S/C22H28O3/c1-3-25-19-6-4-15(11-20(19)24-2)5-7-21(23)22-12-16-8-17(13-22)10-18(9-16)14-22/h4-7,11,16-18H,3,8-10,12-14H2,1-2H3/b7-5+ |
| InChIKey | MFIDDIVYMBWPMH-FNORWQNLSA-N |
| XLogP | 4.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|