C23H23N3O5S — CID 168620693
2-[2-[[3-(2,3-dihydro-1H-inden-5-yloxymethyl)-4-methoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168620693) has the molecular formula C23H23N3O5S and a molecular weight of 453.52 g/mol. Its IUPAC name is 2-[2-[[3-(2,3-dihydro-1H-inden-5-yloxymethyl)-4-methoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[[3-(2,3-dihydro-1H-inden-5-yloxymethyl)-4-methoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168620693 |
| Molecular Formula | C23H23N3O5S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 2-[2-[[3-(2,3-dihydro-1H-inden-5-yloxymethyl)-4-methoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | COc1ccc(C=NN=C2NC(=O)C(CC(=O)O)S2)cc1COc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C23H23N3O5S/c1-30-19-8-5-14(12-24-26-23-25-22(29)20(32-23)11-21(27)28)9-17(19)13-31-18-7-6-15-3-2-4-16(15)10-18/h5-10,12,20H,2-4,11,13H2,1H3,(H,27,28)(H,25,26,29) |
| InChIKey | ZQVVYMOYSFYKDV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|